C13H14FNO5 — CID 54679737
(Z)-4-[(4-fluoro-3-methylphenyl)methyl-methoxyamino]-2-hydroxy-4-oxobut-2-enoic acid (PubChem CID 54679737) has the molecular formula C13H14FNO5 and a molecular weight of 283.26 g/mol. Its IUPAC name is (Z)-4-[(4-fluoro-3-methylphenyl)methyl-methoxyamino]-2-hydroxy-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[(4-fluoro-3-methylphenyl)methyl-methoxyamino]-2-hydroxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54679737 |
| Molecular Formula | C13H14FNO5 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | (Z)-4-[(4-fluoro-3-methylphenyl)methyl-methoxyamino]-2-hydroxy-4-oxobut-2-enoic acid |
| SMILES | CON(Cc1ccc(F)c(C)c1)C(=O)/C=C(\O)C(=O)O |
| InChI | InChI=1S/C13H14FNO5/c1-8-5-9(3-4-10(8)14)7-15(20-2)12(17)6-11(16)13(18)19/h3-6,16H,7H2,1-2H3,(H,18,19)/b11-6- |
| InChIKey | RRJDARGXOYTXNN-WDZFZDKYSA-N |
| XLogP | 1.55 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|