C17H22FNO2 — CID 166431573
N-[(4-fluoro-3-methylphenyl)methyl]-N-[(1S,2R)-2-methoxycyclopentyl]prop-2-enamide (PubChem CID 166431573) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is N-[(4-fluoro-3-methylphenyl)methyl]-N-[(1S,2R)-2-methoxycyclopentyl]prop-2-enamide.
| Compound Name | N-[(4-fluoro-3-methylphenyl)methyl]-N-[(1S,2R)-2-methoxycyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 166431573 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-[(4-fluoro-3-methylphenyl)methyl]-N-[(1S,2R)-2-methoxycyclopentyl]prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1ccc(F)c(C)c1)[C@H]1CCC[C@H]1OC |
| InChI | InChI=1S/C17H22FNO2/c1-4-17(20)19(15-6-5-7-16(15)21-3)11-13-8-9-14(18)12(2)10-13/h4,8-10,15-16H,1,5-7,11H2,2-3H3/t15-,16+/m0/s1 |
| InChIKey | LSJVGAQJPKSWIE-JKSUJKDBSA-N |
| XLogP | 3.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|