C16H17F2NO2 — CID 166419955
N-[(2,5-difluorophenyl)methyl]-N-[(1R,2R,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]prop-2-enamide (PubChem CID 166419955) has the molecular formula C16H17F2NO2 and a molecular weight of 293.31 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-N-[(1R,2R,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]prop-2-enamide.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-N-[(1R,2R,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 166419955 |
| Molecular Formula | C16H17F2NO2 |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-N-[(1R,2R,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1cc(F)ccc1F)[C@@H]1C[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C16H17F2NO2/c1-2-16(20)19(14-8-12-4-6-15(14)21-12)9-10-7-11(17)3-5-13(10)18/h2-3,5,7,12,14-15H,1,4,6,8-9H2/t12-,14+,15+/m0/s1 |
| InChIKey | KDTATXLAWAJKOE-NWANDNLSSA-N |
| XLogP | 2.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|