C13H12ClFO2 — CID 105394244
(2-chloro-5-fluorophenyl)-(7-oxabicyclo[2.2.1]heptan-2-yl)methanone (PubChem CID 105394244) has the molecular formula C13H12ClFO2 and a molecular weight of 254.69 g/mol. Its IUPAC name is (2-chloro-5-fluorophenyl)-(7-oxabicyclo[2.2.1]heptan-2-yl)methanone.
| Compound Name | (2-chloro-5-fluorophenyl)-(7-oxabicyclo[2.2.1]heptan-2-yl)methanone |
|---|---|
| PubChem CID | 105394244 |
| Molecular Formula | C13H12ClFO2 |
| Molecular Weight | 254.69 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | (2-chloro-5-fluorophenyl)-(7-oxabicyclo[2.2.1]heptan-2-yl)methanone |
| SMILES | O=C(c1cc(F)ccc1Cl)C1CC2CCC1O2 |
| InChI | InChI=1S/C13H12ClFO2/c14-11-3-1-7(15)5-9(11)13(16)10-6-8-2-4-12(10)17-8/h1,3,5,8,10,12H,2,4,6H2 |
| InChIKey | VLJNTOWOBUDHLA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.69 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |