C14H16F2O2 — CID 171961687
3-[(2,5-difluorophenyl)methyl]-8-oxabicyclo[3.2.1]octan-3-ol (PubChem CID 171961687) has the molecular formula C14H16F2O2 and a molecular weight of 254.28 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)methyl]-8-oxabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[(2,5-difluorophenyl)methyl]-8-oxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171961687 |
| Molecular Formula | C14H16F2O2 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-[(2,5-difluorophenyl)methyl]-8-oxabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(Cc2cc(F)ccc2F)CC2CCC(C1)O2 |
| InChI | InChI=1S/C14H16F2O2/c15-10-1-4-13(16)9(5-10)6-14(17)7-11-2-3-12(8-14)18-11/h1,4-5,11-12,17H,2-3,6-8H2 |
| InChIKey | CXILNPWZQBYIRV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |