C15H17BrF2 — CID 66049494
2-(bromomethyl)-2-[(2,5-difluorophenyl)methyl]bicyclo[2.2.1]heptane (PubChem CID 66049494) has the molecular formula C15H17BrF2 and a molecular weight of 315.20 g/mol. Its IUPAC name is 2-(bromomethyl)-2-[(2,5-difluorophenyl)methyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-(bromomethyl)-2-[(2,5-difluorophenyl)methyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 66049494 |
| Molecular Formula | C15H17BrF2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-(bromomethyl)-2-[(2,5-difluorophenyl)methyl]bicyclo[2.2.1]heptane |
| SMILES | Fc1ccc(F)c(CC2(CBr)CC3CCC2C3)c1 |
| InChI | InChI=1S/C15H17BrF2/c16-9-15(7-10-1-2-12(15)5-10)8-11-6-13(17)3-4-14(11)18/h3-4,6,10,12H,1-2,5,7-9H2 |
| InChIKey | KZBAIPASCBAILL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|