C20H18F2N2O5 — CID 54689390
2-[[(Z)-4-[bis[(4-fluorophenyl)methyl]amino]-2-hydroxy-4-oxobut-2-enoyl]amino]acetic acid (PubChem CID 54689390) has the molecular formula C20H18F2N2O5 and a molecular weight of 404.37 g/mol. Its IUPAC name is 2-[[(Z)-4-[bis[(4-fluorophenyl)methyl]amino]-2-hydroxy-4-oxobut-2-enoyl]amino]acetic acid.
| Compound Name | 2-[[(Z)-4-[bis[(4-fluorophenyl)methyl]amino]-2-hydroxy-4-oxobut-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 54689390 |
| Molecular Formula | C20H18F2N2O5 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-[[(Z)-4-[bis[(4-fluorophenyl)methyl]amino]-2-hydroxy-4-oxobut-2-enoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)/C(O)=C/C(=O)N(Cc1ccc(F)cc1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H18F2N2O5/c21-15-5-1-13(2-6-15)11-24(12-14-3-7-16(22)8-4-14)18(26)9-17(25)20(29)23-10-19(27)28/h1-9,25H,10-12H2,(H,23,29)(H,27,28)/b17-9- |
| InChIKey | DPPCTPNQLJPTCX-MFOYZWKCSA-N |
| XLogP | 2.14 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|