C30H31F2N3O6S — CID 54686591
(Z)-N-[6-(benzenesulfonamido)-6-oxohexyl]-N',N'-bis[(4-fluorophenyl)methyl]-2-hydroxybut-2-enediamide (PubChem CID 54686591) has the molecular formula C30H31F2N3O6S and a molecular weight of 599.66 g/mol. Its IUPAC name is (Z)-N-[6-(benzenesulfonamido)-6-oxohexyl]-N',N'-bis[(4-fluorophenyl)methyl]-2-hydroxybut-2-enediamide.
| Compound Name | (Z)-N-[6-(benzenesulfonamido)-6-oxohexyl]-N',N'-bis[(4-fluorophenyl)methyl]-2-hydroxybut-2-enediamide |
|---|---|
| PubChem CID | 54686591 |
| Molecular Formula | C30H31F2N3O6S |
| Molecular Weight | 599.66 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | (Z)-N-[6-(benzenesulfonamido)-6-oxohexyl]-N',N'-bis[(4-fluorophenyl)methyl]-2-hydroxybut-2-enediamide |
| SMILES | O=C(CCCCCNC(=O)/C(O)=C/C(=O)N(Cc1ccc(F)cc1)Cc1ccc(F)cc1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H31F2N3O6S/c31-24-14-10-22(11-15-24)20-35(21-23-12-16-25(32)17-13-23)29(38)19-27(36)30(39)33-18-6-2-5-9-28(37)34-42(40,41)26-7-3-1-4-8-26/h1,3-4,7-8,10-17,19,36H,2,5-6,9,18,20-21H2,(H,33,39)(H,34,37)/b27-19- |
| InChIKey | GJXCIEJXOKPAOE-DIBXZPPDSA-N |
| XLogP | 4.12 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.66 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|