C24H37N3O6S — CID 126483539
N'-[(Z)-13-[2-(benzenesulfonamido)-2-oxoethoxy]tridec-5-enyl]-N-methyloxamide (PubChem CID 126483539) has the molecular formula C24H37N3O6S and a molecular weight of 495.64 g/mol. Its IUPAC name is N'-[(Z)-13-[2-(benzenesulfonamido)-2-oxoethoxy]tridec-5-enyl]-N-methyloxamide.
| Compound Name | N'-[(Z)-13-[2-(benzenesulfonamido)-2-oxoethoxy]tridec-5-enyl]-N-methyloxamide |
|---|---|
| PubChem CID | 126483539 |
| Molecular Formula | C24H37N3O6S |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | N'-[(Z)-13-[2-(benzenesulfonamido)-2-oxoethoxy]tridec-5-enyl]-N-methyloxamide |
| SMILES | CNC(=O)C(=O)NCCCC/C=C\CCCCCCCOCC(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H37N3O6S/c1-25-23(29)24(30)26-18-14-9-7-5-3-2-4-6-8-10-15-19-33-20-22(28)27-34(31,32)21-16-12-11-13-17-21/h3,5,11-13,16-17H,2,4,6-10,14-15,18-20H2,1H3,(H,25,29)(H,26,30)(H,27,28)/b5-3- |
| InChIKey | MISWWNKZRUMUKF-HYXAFXHYSA-N |
| XLogP | 2.44 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|