C31H56N2O8 — CID 163892701
ethyl 2-hept-6-enoxyacetate;ethyl 2-[(Z)-13-[[2-(methylamino)-2-oxoacetyl]amino]tridec-8-enoxy]acetate (PubChem CID 163892701) has the molecular formula C31H56N2O8 and a molecular weight of 584.80 g/mol. Its IUPAC name is ethyl 2-hept-6-enoxyacetate;ethyl 2-[(Z)-13-[[2-(methylamino)-2-oxoacetyl]amino]tridec-8-enoxy]acetate.
| Compound Name | ethyl 2-hept-6-enoxyacetate;ethyl 2-[(Z)-13-[[2-(methylamino)-2-oxoacetyl]amino]tridec-8-enoxy]acetate |
|---|---|
| PubChem CID | 163892701 |
| Molecular Formula | C31H56N2O8 |
| Molecular Weight | 584.80 g/mol |
| Exact Mass | 584.40 |
| IUPAC Name | ethyl 2-hept-6-enoxyacetate;ethyl 2-[(Z)-13-[[2-(methylamino)-2-oxoacetyl]amino]tridec-8-enoxy]acetate |
| SMILES | C=CCCCCCOCC(=O)OCC.CCOC(=O)COCCCCCCC/C=C\CCCCNC(=O)C(=O)NC |
| InChI | InChI=1S/C20H36N2O5.C11H20O3/c1-3-27-18(23)17-26-16-14-12-10-8-6-4-5-7-9-11-13-15-22-20(25)19(24)21-2;1-3-5-6-7-8-9-13-10-11(12)14-4-2/h5,7H,3-4,6,8-17H2,1-2H3,(H,21,24)(H,22,25);3H,1,4-10H2,2H3/b7-5-; |
| InChIKey | QCXIUHZOMXUTJW-YJOCEBFMSA-N |
| XLogP | 4.81 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.80 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|