C17H32N3O5- — CID 163891057
N'-[(Z)-13-[[hydroxy(oxido)amino]methoxy]tridec-5-enyl]-N-methyloxamide (PubChem CID 163891057) has the molecular formula C17H32N3O5- and a molecular weight of 358.46 g/mol. Its IUPAC name is N'-[(Z)-13-[[hydroxy(oxido)amino]methoxy]tridec-5-enyl]-N-methyloxamide.
| Compound Name | N'-[(Z)-13-[[hydroxy(oxido)amino]methoxy]tridec-5-enyl]-N-methyloxamide |
|---|---|
| PubChem CID | 163891057 |
| Molecular Formula | C17H32N3O5- |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | N'-[(Z)-13-[[hydroxy(oxido)amino]methoxy]tridec-5-enyl]-N-methyloxamide |
| SMILES | CNC(=O)C(=O)NCCCC/C=C\CCCCCCCOCN([O-])O |
| InChI | InChI=1S/C17H32N3O5/c1-18-16(21)17(22)19-13-11-9-7-5-3-2-4-6-8-10-12-14-25-15-20(23)24/h3,5,23H,2,4,6-15H2,1H3,(H,18,21)(H,19,22)/q-1/b5-3- |
| InChIKey | NSQPIKFTMOMDHZ-HYXAFXHYSA-N |
| XLogP | 2.08 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|