C19H35NO3 — CID 159151259
N-[(Z)-15-hydroxypentadec-5-enyl]-2-oxobutanamide (PubChem CID 159151259) has the molecular formula C19H35NO3 and a molecular weight of 325.49 g/mol. Its IUPAC name is N-[(Z)-15-hydroxypentadec-5-enyl]-2-oxobutanamide.
| Compound Name | N-[(Z)-15-hydroxypentadec-5-enyl]-2-oxobutanamide |
|---|---|
| PubChem CID | 159151259 |
| Molecular Formula | C19H35NO3 |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | N-[(Z)-15-hydroxypentadec-5-enyl]-2-oxobutanamide |
| SMILES | CCC(=O)C(=O)NCCCC/C=C\CCCCCCCCCO |
| InChI | InChI=1S/C19H35NO3/c1-2-18(22)19(23)20-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-21/h6,8,21H,2-5,7,9-17H2,1H3,(H,20,23)/b8-6- |
| InChIKey | IQSGKVQDFKPTLH-VURMDHGXSA-N |
| XLogP | 3.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|