C18H34N2O5S — CID 118256706
(Z)-15-[[2-(methylamino)-2-oxoacetyl]amino]pentadec-10-ene-1-sulfonic acid (PubChem CID 118256706) has the molecular formula C18H34N2O5S and a molecular weight of 390.55 g/mol. Its IUPAC name is (Z)-15-[[2-(methylamino)-2-oxoacetyl]amino]pentadec-10-ene-1-sulfonic acid.
| Compound Name | (Z)-15-[[2-(methylamino)-2-oxoacetyl]amino]pentadec-10-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 118256706 |
| Molecular Formula | C18H34N2O5S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (Z)-15-[[2-(methylamino)-2-oxoacetyl]amino]pentadec-10-ene-1-sulfonic acid |
| SMILES | CNC(=O)C(=O)NCCCC/C=C\CCCCCCCCCS(=O)(=O)O |
| InChI | InChI=1S/C18H34N2O5S/c1-19-17(21)18(22)20-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-26(23,24)25/h5,7H,2-4,6,8-16H2,1H3,(H,19,21)(H,20,22)(H,23,24,25)/b7-5- |
| InChIKey | UIICGPJGDFLLHO-ALCCZGGFSA-N |
| XLogP | 2.58 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|