C22H34N2O4 — CID 126483551
N'-[(Z)-14-(2-hydroxyphenoxy)tetradec-6-enyl]oxamide (PubChem CID 126483551) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is N'-[(Z)-14-(2-hydroxyphenoxy)tetradec-6-enyl]oxamide.
| Compound Name | N'-[(Z)-14-(2-hydroxyphenoxy)tetradec-6-enyl]oxamide |
|---|---|
| PubChem CID | 126483551 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | N'-[(Z)-14-(2-hydroxyphenoxy)tetradec-6-enyl]oxamide |
| SMILES | NC(=O)C(=O)NCCCCC/C=C\CCCCCCCOc1ccccc1O |
| InChI | InChI=1S/C22H34N2O4/c23-21(26)22(27)24-17-13-9-7-5-3-1-2-4-6-8-10-14-18-28-20-16-12-11-15-19(20)25/h1,3,11-12,15-16,25H,2,4-10,13-14,17-18H2,(H2,23,26)(H,24,27)/b3-1- |
| InChIKey | SEEMWXBLHNTWHA-IWQZZHSRSA-N |
| XLogP | 3.83 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|