C22H28N2O4 — CID 175107069
N'-[4-[2-[3-[2-(hydroxymethyl)phenoxy]propyl]phenyl]butyl]oxamide (PubChem CID 175107069) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is N'-[4-[2-[3-[2-(hydroxymethyl)phenoxy]propyl]phenyl]butyl]oxamide.
| Compound Name | N'-[4-[2-[3-[2-(hydroxymethyl)phenoxy]propyl]phenyl]butyl]oxamide |
|---|---|
| PubChem CID | 175107069 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N'-[4-[2-[3-[2-(hydroxymethyl)phenoxy]propyl]phenyl]butyl]oxamide |
| SMILES | NC(=O)C(=O)NCCCCc1ccccc1CCCOc1ccccc1CO |
| InChI | InChI=1S/C22H28N2O4/c23-21(26)22(27)24-14-6-5-10-17-8-1-2-9-18(17)12-7-15-28-20-13-4-3-11-19(20)16-25/h1-4,8-9,11,13,25H,5-7,10,12,14-16H2,(H2,23,26)(H,24,27) |
| InChIKey | JWZJNRYOSONUCS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|