C16H23BrN2O2 — CID 126483485
N'-[4-[2-(3-bromopropyl)phenyl]butyl]-N-methyloxamide (PubChem CID 126483485) has the molecular formula C16H23BrN2O2 and a molecular weight of 355.28 g/mol. Its IUPAC name is N'-[4-[2-(3-bromopropyl)phenyl]butyl]-N-methyloxamide.
| Compound Name | N'-[4-[2-(3-bromopropyl)phenyl]butyl]-N-methyloxamide |
|---|---|
| PubChem CID | 126483485 |
| Molecular Formula | C16H23BrN2O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N'-[4-[2-(3-bromopropyl)phenyl]butyl]-N-methyloxamide |
| SMILES | CNC(=O)C(=O)NCCCCc1ccccc1CCCBr |
| InChI | InChI=1S/C16H23BrN2O2/c1-18-15(20)16(21)19-12-5-4-9-13-7-2-3-8-14(13)10-6-11-17/h2-3,7-8H,4-6,9-12H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | OGDUCRWZYVKUJN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|