C14H20N2O3 — CID 50850958
N-(6-hydroxyhexyl)-N'-phenyloxamide (PubChem CID 50850958) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)-N'-phenyloxamide.
| Compound Name | N-(6-hydroxyhexyl)-N'-phenyloxamide |
|---|---|
| PubChem CID | 50850958 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-(6-hydroxyhexyl)-N'-phenyloxamide |
| SMILES | O=C(NCCCCCCO)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C14H20N2O3/c17-11-7-2-1-6-10-15-13(18)14(19)16-12-8-4-3-5-9-12/h3-5,8-9,17H,1-2,6-7,10-11H2,(H,15,18)(H,16,19) |
| InChIKey | BNPHLXOAPJCYSP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|