C11H13BrN2O3 — CID 568365
N'-(3-bromophenyl)-N-(3-hydroxypropyl)oxamide (PubChem CID 568365) has the molecular formula C11H13BrN2O3 and a molecular weight of 301.14 g/mol. Its IUPAC name is N'-(3-bromophenyl)-N-(3-hydroxypropyl)oxamide.
| Compound Name | N'-(3-bromophenyl)-N-(3-hydroxypropyl)oxamide |
|---|---|
| PubChem CID | 568365 |
| Molecular Formula | C11H13BrN2O3 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | N'-(3-bromophenyl)-N-(3-hydroxypropyl)oxamide |
| SMILES | O=C(NCCCO)C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C11H13BrN2O3/c12-8-3-1-4-9(7-8)14-11(17)10(16)13-5-2-6-15/h1,3-4,7,15H,2,5-6H2,(H,13,16)(H,14,17) |
| InChIKey | GUIYJIRQMDXNBT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|