C11H23ClN4O — CID 115607154
N-(1H-imidazol-5-ylmethyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine;hydrochloride (PubChem CID 115607154) has the molecular formula C11H23ClN4O and a molecular weight of 262.78 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine;hydrochloride.
| Compound Name | N-(1H-imidazol-5-ylmethyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 115607154 |
| Molecular Formula | C11H23ClN4O |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)-N'-(2-methoxyethyl)-N'-methylpropane-1,3-diamine;hydrochloride |
| SMILES | COCCN(C)CCCNCc1cnc[nH]1.Cl |
| InChI | InChI=1S/C11H22N4O.ClH/c1-15(6-7-16-2)5-3-4-12-8-11-9-13-10-14-11;/h9-10,12H,3-8H2,1-2H3,(H,13,14);1H |
| InChIKey | LVPPDUNXZBHQBB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|