About (3-hydroxy-2-pyridinyl)methyl-trimethylazanium;acetate;bromide
(3-hydroxy-2-pyridinyl)methyl-trimethylazanium;acetate;bromide (PubChem CID 23622310) has the molecular formula C11H18BrN2O3-
and a molecular weight of 306.18 g/mol. Its IUPAC name is (3-hydroxy-2-pyridinyl)methyl-trimethylazanium;acetate;bromide.
Molecular Properties
| Compound Name | (3-hydroxy-2-pyridinyl)methyl-trimethylazanium;acetate;bromide |
| PubChem CID | 23622310 |
| Molecular Formula | C11H18BrN2O3- |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | (3-hydroxy-2-pyridinyl)methyl-trimethylazanium;acetate;bromide |
| SMILES | CC(=O)[O-].C[N+](C)(C)Cc1ncccc1O.[Br-] |
| InChI | InChI=1S/C9H14N2O.C2H4O2.BrH/c1-11(2,3)7-8-9(12)5-4-6-10-8;1-2(3)4;/h4-6H,7H2,1-3H3;1H3,(H,3,4);1H/p-1 |
| InChIKey | VJTHUWWFQHWHBP-UHFFFAOYSA-M |
| XLogP | -3.25 |
| TPSA | 73.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-2-pyridinyl)methyl-trimethylazanium;acetate;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2-pyridinyl)methyl-trimethylazanium;acetate;bromide?
The IUPAC name of (3-hydroxy-2-pyridinyl)methyl-trimethylazanium;acetate;bromide (CID 23622310) is (3-hydroxy-2-pyridinyl)methyl-trimethylazanium;acetate;bromide.
What is the SMILES notation for (3-hydroxy-2-pyridinyl)methyl-trimethylazanium;acetate;bromide?
The canonical SMILES for (3-hydroxy-2-pyridinyl)methyl-trimethylazanium;acetate;bromide is CC(=O)[O-].C[N+](C)(C)Cc1ncccc1O.[Br-].
What is the InChIKey of (3-hydroxy-2-pyridinyl)methyl-trimethylazanium;acetate;bromide?
The InChIKey is VJTHUWWFQHWHBP-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H14N2O.C2H4O2.BrH/c1-11(2,3)7-8-9(12)5-4-6-10-8;1-2(3)4;/h4-6H,7H2,1-3H3;1H3,(H,3,4);1H/p-1.
What are the key properties of (3-hydroxy-2-pyridinyl)methyl-trimethylazanium;acetate;bromide?
(3-hydroxy-2-pyridinyl)methyl-trimethylazanium;acetate;bromide has a molecular weight of 306.18 g/mol, XLogP of -3.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2-pyridinyl)methyl-trimethylazanium;acetate;bromide is sourced from PubChem (CID 23622310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).