C36H24Cl2N2O8 — CID 20645318
[6,13-dichloro-3-(2-methoxybenzoyl)oxy-2,9-dimethyl-[1,4]benzoxazino[2,3-b]phenoxazin-10-yl] 2-methoxybenzoate (PubChem CID 20645318) has the molecular formula C36H24Cl2N2O8 and a molecular weight of 683.50 g/mol. Its IUPAC name is [6,13-dichloro-3-(2-methoxybenzoyl)oxy-2,9-dimethyl-[1,4]benzoxazino[2,3-b]phenoxazin-10-yl] 2-methoxybenzoate.
| Compound Name | [6,13-dichloro-3-(2-methoxybenzoyl)oxy-2,9-dimethyl-[1,4]benzoxazino[2,3-b]phenoxazin-10-yl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 20645318 |
| Molecular Formula | C36H24Cl2N2O8 |
| Molecular Weight | 683.50 g/mol |
| Exact Mass | 682.09 |
| IUPAC Name | [6,13-dichloro-3-(2-methoxybenzoyl)oxy-2,9-dimethyl-[1,4]benzoxazino[2,3-b]phenoxazin-10-yl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)Oc1cc2c(cc1C)N=c1c(Cl)c3c(c(Cl)c1O2)=Nc1cc(C)c(OC(=O)c2ccccc2OC)cc1O3 |
| InChI | InChI=1S/C36H24Cl2N2O8/c1-17-13-21-27(15-25(17)47-35(41)19-9-5-7-11-23(19)43-3)45-33-30(38)32-34(29(37)31(33)39-21)46-28-16-26(18(2)14-22(28)40-32)48-36(42)20-10-6-8-12-24(20)44-4/h5-16H,1-4H3 |
| InChIKey | VWUZGEITIQEISP-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 114.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.50 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|