C16H16ClN3O3 — CID 6324379
[(E)-[amino-(2-chloro-4,6-dimethyl-3-pyridinyl)methylidene]amino] 2-methoxybenzoate (PubChem CID 6324379) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is [(E)-[amino-(2-chloro-4,6-dimethyl-3-pyridinyl)methylidene]amino] 2-methoxybenzoate.
| Compound Name | [(E)-[amino-(2-chloro-4,6-dimethyl-3-pyridinyl)methylidene]amino] 2-methoxybenzoate |
|---|---|
| PubChem CID | 6324379 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | [(E)-[amino-(2-chloro-4,6-dimethyl-3-pyridinyl)methylidene]amino] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)O/N=C(/N)c1c(C)cc(C)nc1Cl |
| InChI | InChI=1S/C16H16ClN3O3/c1-9-8-10(2)19-14(17)13(9)15(18)20-23-16(21)11-6-4-5-7-12(11)22-3/h4-8H,1-3H3,(H2,18,20) |
| InChIKey | SHPMEWNOKBSHNV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|