C18H14Cl2N2O2S — CID 8511475
[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate (PubChem CID 8511475) has the molecular formula C18H14Cl2N2O2S and a molecular weight of 393.30 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate.
| Compound Name | [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 8511475 |
| Molecular Formula | C18H14Cl2N2O2S |
| Molecular Weight | 393.30 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)OCc2csc(-c3ccccc3Cl)n2)c(Cl)n1 |
| InChI | InChI=1S/C18H14Cl2N2O2S/c1-10-7-11(2)21-16(20)15(10)18(23)24-8-12-9-25-17(22-12)13-5-3-4-6-14(13)19/h3-7,9H,8H2,1-2H3 |
| InChIKey | SVWNLXJOWGBDTC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.30 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|