C18H15ClN2O4S2 — CID 30937526
[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-(methanesulfonamido)benzoate (PubChem CID 30937526) has the molecular formula C18H15ClN2O4S2 and a molecular weight of 422.92 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-(methanesulfonamido)benzoate.
| Compound Name | [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 30937526 |
| Molecular Formula | C18H15ClN2O4S2 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 4-(methanesulfonamido)benzoate |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)OCc2csc(-c3ccccc3Cl)n2)cc1 |
| InChI | InChI=1S/C18H15ClN2O4S2/c1-27(23,24)21-13-8-6-12(7-9-13)18(22)25-10-14-11-26-17(20-14)15-4-2-3-5-16(15)19/h2-9,11,21H,10H2,1H3 |
| InChIKey | FECMKGHHFDTEJG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |