C19H15ClN2O3S — CID 7783403
[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 2-benzamidoacetate (PubChem CID 7783403) has the molecular formula C19H15ClN2O3S and a molecular weight of 386.86 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 2-benzamidoacetate.
| Compound Name | [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 2-benzamidoacetate |
|---|---|
| PubChem CID | 7783403 |
| Molecular Formula | C19H15ClN2O3S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl 2-benzamidoacetate |
| SMILES | O=C(CNC(=O)c1ccccc1)OCc1csc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C19H15ClN2O3S/c20-16-9-5-4-8-15(16)19-22-14(12-26-19)11-25-17(23)10-21-18(24)13-6-2-1-3-7-13/h1-9,12H,10-11H2,(H,21,24) |
| InChIKey | LUVIITJJAYZFGU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |