About 1-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine
1-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine (PubChem CID 12703423) has the molecular formula C16H16ClN3OS
and a molecular weight of 333.84 g/mol. Its IUPAC name is 1-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine.
Molecular Properties
| Compound Name | 1-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine |
| PubChem CID | 12703423 |
| Molecular Formula | C16H16ClN3OS |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 1-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine |
| SMILES | CN1CCN(C2=Nc3ccccc3Oc3c2csc3Cl)CC1 |
| InChI | InChI=1S/C16H16ClN3OS/c1-19-6-8-20(9-7-19)16-11-10-22-15(17)14(11)21-13-5-3-2-4-12(13)18-16/h2-5,10H,6-9H2,1H3 |
| InChIKey | AARPTTJMVGHOMZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine?
The IUPAC name of 1-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine (CID 12703423) is 1-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine.
What is the SMILES notation for 1-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine?
The canonical SMILES for 1-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine is CN1CCN(C2=Nc3ccccc3Oc3c2csc3Cl)CC1.
What is the InChIKey of 1-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine?
The InChIKey is AARPTTJMVGHOMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN3OS/c1-19-6-8-20(9-7-19)16-11-10-22-15(17)14(11)21-13-5-3-2-4-12(13)18-16/h2-5,10H,6-9H2,1H3.
What are the key properties of 1-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine?
1-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine has a molecular weight of 333.84 g/mol, XLogP of 3.83, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-(4-methylpiperazin-1-yl)thieno[3,4-b][1,5]benzoxazepine is sourced from PubChem (CID 12703423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).