C22H21N3OS — CID 18422139
4-(4-methylpiperazin-1-yl)-2-phenylthieno[2,3-b][1,5]benzoxazepine (PubChem CID 18422139) has the molecular formula C22H21N3OS and a molecular weight of 375.50 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-2-phenylthieno[2,3-b][1,5]benzoxazepine.
| Compound Name | 4-(4-methylpiperazin-1-yl)-2-phenylthieno[2,3-b][1,5]benzoxazepine |
|---|---|
| PubChem CID | 18422139 |
| Molecular Formula | C22H21N3OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-2-phenylthieno[2,3-b][1,5]benzoxazepine |
| SMILES | CN1CCN(C2=Nc3ccccc3Oc3sc(-c4ccccc4)cc32)CC1 |
| InChI | InChI=1S/C22H21N3OS/c1-24-11-13-25(14-12-24)21-17-15-20(16-7-3-2-4-8-16)27-22(17)26-19-10-6-5-9-18(19)23-21/h2-10,15H,11-14H2,1H3 |
| InChIKey | JWKSSNWVODFSOP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |