About 2-methyl-4-(4-methylpiperazin-1-yl)-10-oxidothieno[2,3-b][1,5]benzodiazepine
2-methyl-4-(4-methylpiperazin-1-yl)-10-oxidothieno[2,3-b][1,5]benzodiazepine (PubChem CID 18315391) has the molecular formula C17H19N4OS-
and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-methyl-4-(4-methylpiperazin-1-yl)-10-oxidothieno[2,3-b][1,5]benzodiazepine.
Molecular Properties
| Compound Name | 2-methyl-4-(4-methylpiperazin-1-yl)-10-oxidothieno[2,3-b][1,5]benzodiazepine |
| PubChem CID | 18315391 |
| Molecular Formula | C17H19N4OS- |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-methyl-4-(4-methylpiperazin-1-yl)-10-oxidothieno[2,3-b][1,5]benzodiazepine |
| SMILES | Cc1cc2c(s1)N([O-])c1ccccc1N=C2N1CCN(C)CC1 |
| InChI | InChI=1S/C17H19N4OS/c1-12-11-13-16(20-9-7-19(2)8-10-20)18-14-5-3-4-6-15(14)21(22)17(13)23-12/h3-6,11H,7-10H2,1-2H3/q-1 |
| InChIKey | HEIVNMUESQMRCA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-4-(4-methylpiperazin-1-yl)-10-oxidothieno[2,3-b][1,5]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(4-methylpiperazin-1-yl)-10-oxidothieno[2,3-b][1,5]benzodiazepine?
The IUPAC name of 2-methyl-4-(4-methylpiperazin-1-yl)-10-oxidothieno[2,3-b][1,5]benzodiazepine (CID 18315391) is 2-methyl-4-(4-methylpiperazin-1-yl)-10-oxidothieno[2,3-b][1,5]benzodiazepine.
What is the SMILES notation for 2-methyl-4-(4-methylpiperazin-1-yl)-10-oxidothieno[2,3-b][1,5]benzodiazepine?
The canonical SMILES for 2-methyl-4-(4-methylpiperazin-1-yl)-10-oxidothieno[2,3-b][1,5]benzodiazepine is Cc1cc2c(s1)N([O-])c1ccccc1N=C2N1CCN(C)CC1.
What is the InChIKey of 2-methyl-4-(4-methylpiperazin-1-yl)-10-oxidothieno[2,3-b][1,5]benzodiazepine?
The InChIKey is HEIVNMUESQMRCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N4OS/c1-12-11-13-16(20-9-7-19(2)8-10-20)18-14-5-3-4-6-15(14)21(22)17(13)23-12/h3-6,11H,7-10H2,1-2H3/q-1.
What are the key properties of 2-methyl-4-(4-methylpiperazin-1-yl)-10-oxidothieno[2,3-b][1,5]benzodiazepine?
2-methyl-4-(4-methylpiperazin-1-yl)-10-oxidothieno[2,3-b][1,5]benzodiazepine has a molecular weight of 327.43 g/mol, XLogP of 3.33, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(4-methylpiperazin-1-yl)-10-oxidothieno[2,3-b][1,5]benzodiazepine is sourced from PubChem (CID 18315391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).