C23H28N4O6S — CID 46782615
(3S,4S,5S,6R)-3,4,5-trihydroxy-6-[2-methyl-4-[4-(trideuteriomethyl)piperazin-1-yl]thieno[2,3-b][1,5]benzodiazepin-10-yl]oxane-2-carboxylic acid (PubChem CID 46782615) has the molecular formula C23H28N4O6S and a molecular weight of 491.58 g/mol. Its IUPAC name is (3S,4S,5S,6R)-3,4,5-trihydroxy-6-[2-methyl-4-[4-(trideuteriomethyl)piperazin-1-yl]thieno[2,3-b][1,5]benzodiazepin-10-yl]oxane-2-carboxylic acid.
| Compound Name | (3S,4S,5S,6R)-3,4,5-trihydroxy-6-[2-methyl-4-[4-(trideuteriomethyl)piperazin-1-yl]thieno[2,3-b][1,5]benzodiazepin-10-yl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 46782615 |
| Molecular Formula | C23H28N4O6S |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | (3S,4S,5S,6R)-3,4,5-trihydroxy-6-[2-methyl-4-[4-(trideuteriomethyl)piperazin-1-yl]thieno[2,3-b][1,5]benzodiazepin-10-yl]oxane-2-carboxylic acid |
| SMILES | [2H]C([2H])([2H])N1CCN(C2=Nc3ccccc3N([C@@H]3OC(C(=O)O)[C@@H](O)[C@H](O)[C@@H]3O)c3sc(C)cc32)CC1 |
| InChI | InChI=1S/C23H28N4O6S/c1-12-11-13-20(26-9-7-25(2)8-10-26)24-14-5-3-4-6-15(14)27(22(13)34-12)21-18(30)16(28)17(29)19(33-21)23(31)32/h3-6,11,16-19,21,28-30H,7-10H2,1-2H3,(H,31,32)/t16-,17-,18-,19?,21+/m0/s1/i2D3 |
| InChIKey | GAMKTHIOQWRUNL-NDAFKCSQSA-N |
| XLogP | 0.73 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |