C17H21IN4S — CID 173063339
2-methyl-4-(4-methylpiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepine;hydroiodide (PubChem CID 173063339) has the molecular formula C17H21IN4S and a molecular weight of 440.35 g/mol. Its IUPAC name is 2-methyl-4-(4-methylpiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepine;hydroiodide.
| Compound Name | 2-methyl-4-(4-methylpiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepine;hydroiodide |
|---|---|
| PubChem CID | 173063339 |
| Molecular Formula | C17H21IN4S |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 2-methyl-4-(4-methylpiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepine;hydroiodide |
| SMILES | Cc1cc2c(s1)Nc1ccccc1N=C2N1CCN(C)CC1.I |
| InChI | InChI=1S/C17H20N4S.HI/c1-12-11-13-16(21-9-7-20(2)8-10-21)18-14-5-3-4-6-15(14)19-17(13)22-12;/h3-6,11,19H,7-10H2,1-2H3;1H |
| InChIKey | NEMRVIFGNHKBES-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|