C21H28N4OS — CID 135525306
4-[(3S)-3-(2-ethoxyethyl)-4-methylpiperazin-1-yl]-2-methyl-10H-thieno[2,3-b][1,5]benzodiazepine (PubChem CID 135525306) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is 4-[(3S)-3-(2-ethoxyethyl)-4-methylpiperazin-1-yl]-2-methyl-10H-thieno[2,3-b][1,5]benzodiazepine.
| Compound Name | 4-[(3S)-3-(2-ethoxyethyl)-4-methylpiperazin-1-yl]-2-methyl-10H-thieno[2,3-b][1,5]benzodiazepine |
|---|---|
| PubChem CID | 135525306 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-[(3S)-3-(2-ethoxyethyl)-4-methylpiperazin-1-yl]-2-methyl-10H-thieno[2,3-b][1,5]benzodiazepine |
| SMILES | CCOCC[C@H]1CN(C2=Nc3ccccc3Nc3sc(C)cc32)CCN1C |
| InChI | InChI=1S/C21H28N4OS/c1-4-26-12-9-16-14-25(11-10-24(16)3)20-17-13-15(2)27-21(17)23-19-8-6-5-7-18(19)22-20/h5-8,13,16,23H,4,9-12,14H2,1-3H3/t16-/m0/s1 |
| InChIKey | IJGHZJGCNSTLEO-INIZCTEOSA-N |
| XLogP | 4.23 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|