C26H30N4S — CID 135932151
2-methyl-4-[(3S)-3-(4-phenylbutyl)piperazin-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepine (PubChem CID 135932151) has the molecular formula C26H30N4S and a molecular weight of 430.62 g/mol. Its IUPAC name is 2-methyl-4-[(3S)-3-(4-phenylbutyl)piperazin-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepine.
| Compound Name | 2-methyl-4-[(3S)-3-(4-phenylbutyl)piperazin-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepine |
|---|---|
| PubChem CID | 135932151 |
| Molecular Formula | C26H30N4S |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 2-methyl-4-[(3S)-3-(4-phenylbutyl)piperazin-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepine |
| SMILES | Cc1cc2c(s1)Nc1ccccc1N=C2N1CCN[C@@H](CCCCc2ccccc2)C1 |
| InChI | InChI=1S/C26H30N4S/c1-19-17-22-25(28-23-13-7-8-14-24(23)29-26(22)31-19)30-16-15-27-21(18-30)12-6-5-11-20-9-3-2-4-10-20/h2-4,7-10,13-14,17,21,27,29H,5-6,11-12,15-16,18H2,1H3/t21-/m0/s1 |
| InChIKey | OXDLQUVXHIZRLD-NRFANRHFSA-N |
| XLogP | 5.88 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|