About 9-methyl-6-[(3S)-3-(2-phenylethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine
9-methyl-6-[(3S)-3-(2-phenylethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine (PubChem CID 58860620) has the molecular formula C26H28N4
and a molecular weight of 396.54 g/mol. Its IUPAC name is 9-methyl-6-[(3S)-3-(2-phenylethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine.
Molecular Properties
| Compound Name | 9-methyl-6-[(3S)-3-(2-phenylethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine |
| PubChem CID | 58860620 |
| Molecular Formula | C26H28N4 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 9-methyl-6-[(3S)-3-(2-phenylethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine |
| SMILES | Cc1ccc2c(c1)Nc1ccccc1N=C2N1CCN[C@@H](CCc2ccccc2)C1 |
| InChI | InChI=1S/C26H28N4/c1-19-11-14-22-25(17-19)28-23-9-5-6-10-24(23)29-26(22)30-16-15-27-21(18-30)13-12-20-7-3-2-4-8-20/h2-11,14,17,21,27-28H,12-13,15-16,18H2,1H3/t21-/m0/s1 |
| InChIKey | VSHFDGQCQFQCND-NRFANRHFSA-N |
| XLogP | 5.04 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-methyl-6-[(3S)-3-(2-phenylethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-6-[(3S)-3-(2-phenylethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine?
The IUPAC name of 9-methyl-6-[(3S)-3-(2-phenylethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine (CID 58860620) is 9-methyl-6-[(3S)-3-(2-phenylethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine.
What is the SMILES notation for 9-methyl-6-[(3S)-3-(2-phenylethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine?
The canonical SMILES for 9-methyl-6-[(3S)-3-(2-phenylethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine is Cc1ccc2c(c1)Nc1ccccc1N=C2N1CCN[C@@H](CCc2ccccc2)C1.
What is the InChIKey of 9-methyl-6-[(3S)-3-(2-phenylethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine?
The InChIKey is VSHFDGQCQFQCND-NRFANRHFSA-N. The full InChI is InChI=1S/C26H28N4/c1-19-11-14-22-25(17-19)28-23-9-5-6-10-24(23)29-26(22)30-16-15-27-21(18-30)13-12-20-7-3-2-4-8-20/h2-11,14,17,21,27-28H,12-13,15-16,18H2,1H3/t21-/m0/s1.
What are the key properties of 9-methyl-6-[(3S)-3-(2-phenylethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine?
9-methyl-6-[(3S)-3-(2-phenylethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine has a molecular weight of 396.54 g/mol, XLogP of 5.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-6-[(3S)-3-(2-phenylethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine is sourced from PubChem (CID 58860620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).