C28H33N5O2 — CID 135348637
2-ethylbutyl (2E)-2-[3-(3-benzylpiperazin-1-yl)-1H-quinoxalin-2-ylidene]-2-cyanoacetate (PubChem CID 135348637) has the molecular formula C28H33N5O2 and a molecular weight of 471.61 g/mol. Its IUPAC name is 2-ethylbutyl (2E)-2-[3-(3-benzylpiperazin-1-yl)-1H-quinoxalin-2-ylidene]-2-cyanoacetate.
| Compound Name | 2-ethylbutyl (2E)-2-[3-(3-benzylpiperazin-1-yl)-1H-quinoxalin-2-ylidene]-2-cyanoacetate |
|---|---|
| PubChem CID | 135348637 |
| Molecular Formula | C28H33N5O2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 2-ethylbutyl (2E)-2-[3-(3-benzylpiperazin-1-yl)-1H-quinoxalin-2-ylidene]-2-cyanoacetate |
| SMILES | CCC(CC)COC(=O)/C(C#N)=C1/Nc2ccccc2N=C1N1CCNC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C28H33N5O2/c1-3-20(4-2)19-35-28(34)23(17-29)26-27(32-25-13-9-8-12-24(25)31-26)33-15-14-30-22(18-33)16-21-10-6-5-7-11-21/h5-13,20,22,30-31H,3-4,14-16,18-19H2,1-2H3/b26-23+ |
| InChIKey | BSLXBGRVEWHBDY-WNAAXNPUSA-N |
| XLogP | 4.42 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|