C17H18N4O2 — CID 134103035
methyl (2Z)-2-cyano-2-(3-piperidin-1-yl-1H-quinoxalin-2-ylidene)acetate (PubChem CID 134103035) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is methyl (2Z)-2-cyano-2-(3-piperidin-1-yl-1H-quinoxalin-2-ylidene)acetate.
| Compound Name | methyl (2Z)-2-cyano-2-(3-piperidin-1-yl-1H-quinoxalin-2-ylidene)acetate |
|---|---|
| PubChem CID | 134103035 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | methyl (2Z)-2-cyano-2-(3-piperidin-1-yl-1H-quinoxalin-2-ylidene)acetate |
| SMILES | COC(=O)/C(C#N)=C1\Nc2ccccc2N=C1N1CCCCC1 |
| InChI | InChI=1S/C17H18N4O2/c1-23-17(22)12(11-18)15-16(21-9-5-2-6-10-21)20-14-8-4-3-7-13(14)19-15/h3-4,7-8,19H,2,5-6,9-10H2,1H3/b15-12- |
| InChIKey | MVFXEZOBNZOFTD-QINSGFPZSA-N |
| XLogP | 2.58 |
| TPSA | 77.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|