About cyclohexyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate
cyclohexyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate (PubChem CID 70622284) has the molecular formula C16H16N2O3
and a molecular weight of 284.31 g/mol. Its IUPAC name is cyclohexyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate.
Molecular Properties
| Compound Name | cyclohexyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate |
| PubChem CID | 70622284 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | cyclohexyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate |
| SMILES | N#C/C(C(=O)OC1CCCCC1)=C1/Nc2ccccc2O1 |
| InChI | InChI=1S/C16H16N2O3/c17-10-12(16(19)20-11-6-2-1-3-7-11)15-18-13-8-4-5-9-14(13)21-15/h4-5,8-9,11,18H,1-3,6-7H2/b15-12+ |
| InChIKey | IGPNRSNHMVNXES-NTCAYCPXSA-N |
| XLogP | 3.10 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate?
The IUPAC name of cyclohexyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate (CID 70622284) is cyclohexyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate.
What is the SMILES notation for cyclohexyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate?
The canonical SMILES for cyclohexyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate is N#C/C(C(=O)OC1CCCCC1)=C1/Nc2ccccc2O1.
What is the InChIKey of cyclohexyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate?
The InChIKey is IGPNRSNHMVNXES-NTCAYCPXSA-N. The full InChI is InChI=1S/C16H16N2O3/c17-10-12(16(19)20-11-6-2-1-3-7-11)15-18-13-8-4-5-9-14(13)21-15/h4-5,8-9,11,18H,1-3,6-7H2/b15-12+.
What are the key properties of cyclohexyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate?
cyclohexyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate has a molecular weight of 284.31 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-cyanoacetate is sourced from PubChem (CID 70622284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).