C23H29N5O2 — CID 135348638
cycloheptylmethyl (2Z)-2-cyano-2-(3-piperazin-1-yl-1H-quinoxalin-2-ylidene)acetate (PubChem CID 135348638) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is cycloheptylmethyl (2Z)-2-cyano-2-(3-piperazin-1-yl-1H-quinoxalin-2-ylidene)acetate.
| Compound Name | cycloheptylmethyl (2Z)-2-cyano-2-(3-piperazin-1-yl-1H-quinoxalin-2-ylidene)acetate |
|---|---|
| PubChem CID | 135348638 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | cycloheptylmethyl (2Z)-2-cyano-2-(3-piperazin-1-yl-1H-quinoxalin-2-ylidene)acetate |
| SMILES | N#C/C(C(=O)OCC1CCCCCC1)=C1/Nc2ccccc2N=C1N1CCNCC1 |
| InChI | InChI=1S/C23H29N5O2/c24-15-18(23(29)30-16-17-7-3-1-2-4-8-17)21-22(28-13-11-25-12-14-28)27-20-10-6-5-9-19(20)26-21/h5-6,9-10,17,25-26H,1-4,7-8,11-14,16H2/b21-18- |
| InChIKey | HQSZNLBMPALOMD-UZYVYHOESA-N |
| XLogP | 3.34 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|