C29H31FN4O2 — CID 165001719
cyclohexylmethyl (2E)-2-cyano-2-[7-(2-fluorophenyl)-2-piperazin-1-yl-4H-quinolin-3-ylidene]acetate (PubChem CID 165001719) has the molecular formula C29H31FN4O2 and a molecular weight of 486.59 g/mol. Its IUPAC name is cyclohexylmethyl (2E)-2-cyano-2-[7-(2-fluorophenyl)-2-piperazin-1-yl-4H-quinolin-3-ylidene]acetate.
| Compound Name | cyclohexylmethyl (2E)-2-cyano-2-[7-(2-fluorophenyl)-2-piperazin-1-yl-4H-quinolin-3-ylidene]acetate |
|---|---|
| PubChem CID | 165001719 |
| Molecular Formula | C29H31FN4O2 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | cyclohexylmethyl (2E)-2-cyano-2-[7-(2-fluorophenyl)-2-piperazin-1-yl-4H-quinolin-3-ylidene]acetate |
| SMILES | N#C/C(C(=O)OCC1CCCCC1)=C1/Cc2ccc(-c3ccccc3F)cc2N=C1N1CCNCC1 |
| InChI | InChI=1S/C29H31FN4O2/c30-26-9-5-4-8-23(26)21-10-11-22-16-24(28(33-27(22)17-21)34-14-12-32-13-15-34)25(18-31)29(35)36-19-20-6-2-1-3-7-20/h4-5,8-11,17,20,32H,1-3,6-7,12-16,19H2/b25-24+ |
| InChIKey | IIVCIFMECBNUFI-OCOZRVBESA-N |
| XLogP | 4.93 |
| TPSA | 77.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|