C28H30FN5O2 — CID 135348540
cyclohexylmethyl 2-cyano-2-[6-(4-fluorophenyl)-3-piperazin-1-ylquinoxalin-2-yl]acetate (PubChem CID 135348540) has the molecular formula C28H30FN5O2 and a molecular weight of 487.58 g/mol. Its IUPAC name is cyclohexylmethyl 2-cyano-2-[6-(4-fluorophenyl)-3-piperazin-1-ylquinoxalin-2-yl]acetate.
| Compound Name | cyclohexylmethyl 2-cyano-2-[6-(4-fluorophenyl)-3-piperazin-1-ylquinoxalin-2-yl]acetate |
|---|---|
| PubChem CID | 135348540 |
| Molecular Formula | C28H30FN5O2 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | cyclohexylmethyl 2-cyano-2-[6-(4-fluorophenyl)-3-piperazin-1-ylquinoxalin-2-yl]acetate |
| SMILES | N#CC(C(=O)OCC1CCCCC1)c1nc2ccc(-c3ccc(F)cc3)cc2nc1N1CCNCC1 |
| InChI | InChI=1S/C28H30FN5O2/c29-22-9-6-20(7-10-22)21-8-11-24-25(16-21)33-27(34-14-12-31-13-15-34)26(32-24)23(17-30)28(35)36-18-19-4-2-1-3-5-19/h6-11,16,19,23,31H,1-5,12-15,18H2 |
| InChIKey | UJZWLNNPORGHJO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |