C27H29FN6O — CID 6579345
(2S)-2-cyano-N-cyclohexyl-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]quinoxalin-2-yl]acetamide (PubChem CID 6579345) has the molecular formula C27H29FN6O and a molecular weight of 472.57 g/mol. Its IUPAC name is (2S)-2-cyano-N-cyclohexyl-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]quinoxalin-2-yl]acetamide.
| Compound Name | (2S)-2-cyano-N-cyclohexyl-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]quinoxalin-2-yl]acetamide |
|---|---|
| PubChem CID | 6579345 |
| Molecular Formula | C27H29FN6O |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | (2S)-2-cyano-N-cyclohexyl-2-[3-[4-(2-fluorophenyl)piperazin-1-yl]quinoxalin-2-yl]acetamide |
| SMILES | N#C[C@@H](C(=O)NC1CCCCC1)c1nc2ccccc2nc1N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C27H29FN6O/c28-21-10-4-7-13-24(21)33-14-16-34(17-15-33)26-25(31-22-11-5-6-12-23(22)32-26)20(18-29)27(35)30-19-8-2-1-3-9-19/h4-7,10-13,19-20H,1-3,8-9,14-17H2,(H,30,35)/t20-/m1/s1 |
| InChIKey | DQEIFNHDVVRBHQ-HXUWFJFHSA-N |
| XLogP | 4.15 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |