C24H33N5O2 — CID 142447194
cyclohexyl 2-cyano-2-[3-(4-methylpiperazin-1-yl)quinoxalin-2-yl]acetate;ethane (PubChem CID 142447194) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is cyclohexyl 2-cyano-2-[3-(4-methylpiperazin-1-yl)quinoxalin-2-yl]acetate;ethane.
| Compound Name | cyclohexyl 2-cyano-2-[3-(4-methylpiperazin-1-yl)quinoxalin-2-yl]acetate;ethane |
|---|---|
| PubChem CID | 142447194 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | cyclohexyl 2-cyano-2-[3-(4-methylpiperazin-1-yl)quinoxalin-2-yl]acetate;ethane |
| SMILES | CC.CN1CCN(c2nc3ccccc3nc2C(C#N)C(=O)OC2CCCCC2)CC1 |
| InChI | InChI=1S/C22H27N5O2.C2H6/c1-26-11-13-27(14-12-26)21-20(24-18-9-5-6-10-19(18)25-21)17(15-23)22(28)29-16-7-3-2-4-8-16;1-2/h5-6,9-10,16-17H,2-4,7-8,11-14H2,1H3;1-2H3 |
| InChIKey | RQNFTDCUVMIITK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |