C27H30FN5O2 — CID 40894943
2-ethylbutyl (2S)-2-cyano-2-[3-[4-(4-fluorophenyl)piperazin-1-yl]quinoxalin-2-yl]acetate (PubChem CID 40894943) has the molecular formula C27H30FN5O2 and a molecular weight of 475.57 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-cyano-2-[3-[4-(4-fluorophenyl)piperazin-1-yl]quinoxalin-2-yl]acetate.
| Compound Name | 2-ethylbutyl (2S)-2-cyano-2-[3-[4-(4-fluorophenyl)piperazin-1-yl]quinoxalin-2-yl]acetate |
|---|---|
| PubChem CID | 40894943 |
| Molecular Formula | C27H30FN5O2 |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 2-ethylbutyl (2S)-2-cyano-2-[3-[4-(4-fluorophenyl)piperazin-1-yl]quinoxalin-2-yl]acetate |
| SMILES | CCC(CC)COC(=O)[C@H](C#N)c1nc2ccccc2nc1N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H30FN5O2/c1-3-19(4-2)18-35-27(34)22(17-29)25-26(31-24-8-6-5-7-23(24)30-25)33-15-13-32(14-16-33)21-11-9-20(28)10-12-21/h5-12,19,22H,3-4,13-16,18H2,1-2H3/t22-/m1/s1 |
| InChIKey | YLSBVNCYKJXOLW-JOCHJYFZSA-N |
| XLogP | 4.68 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |