C23H29N5O2 — CID 135348643
cyclohexylmethyl 2-cyano-2-[3-(4-methylpiperazin-1-yl)quinoxalin-2-yl]acetate (PubChem CID 135348643) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is cyclohexylmethyl 2-cyano-2-[3-(4-methylpiperazin-1-yl)quinoxalin-2-yl]acetate.
| Compound Name | cyclohexylmethyl 2-cyano-2-[3-(4-methylpiperazin-1-yl)quinoxalin-2-yl]acetate |
|---|---|
| PubChem CID | 135348643 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | cyclohexylmethyl 2-cyano-2-[3-(4-methylpiperazin-1-yl)quinoxalin-2-yl]acetate |
| SMILES | CN1CCN(c2nc3ccccc3nc2C(C#N)C(=O)OCC2CCCCC2)CC1 |
| InChI | InChI=1S/C23H29N5O2/c1-27-11-13-28(14-12-27)22-21(25-19-9-5-6-10-20(19)26-22)18(15-24)23(29)30-16-17-7-3-2-4-8-17/h5-6,9-10,17-18H,2-4,7-8,11-14,16H2,1H3 |
| InChIKey | OUSXXHXXDWCPJU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |