C27H30N4O2 — CID 40818662
butyl (2R)-2-[3-(4-benzylpiperidin-1-yl)quinoxalin-2-yl]-2-cyanoacetate (PubChem CID 40818662) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is butyl (2R)-2-[3-(4-benzylpiperidin-1-yl)quinoxalin-2-yl]-2-cyanoacetate.
| Compound Name | butyl (2R)-2-[3-(4-benzylpiperidin-1-yl)quinoxalin-2-yl]-2-cyanoacetate |
|---|---|
| PubChem CID | 40818662 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | butyl (2R)-2-[3-(4-benzylpiperidin-1-yl)quinoxalin-2-yl]-2-cyanoacetate |
| SMILES | CCCCOC(=O)[C@@H](C#N)c1nc2ccccc2nc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H30N4O2/c1-2-3-17-33-27(32)22(19-28)25-26(30-24-12-8-7-11-23(24)29-25)31-15-13-21(14-16-31)18-20-9-5-4-6-10-20/h4-12,21-22H,2-3,13-18H2,1H3/t22-/m0/s1 |
| InChIKey | CWOVYILZBWGNOO-QFIPXVFZSA-N |
| XLogP | 5.04 |
| TPSA | 79.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|