C29H35N5O2 — CID 40894937
hexyl (2S)-2-cyano-2-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]quinoxalin-2-yl]acetate (PubChem CID 40894937) has the molecular formula C29H35N5O2 and a molecular weight of 485.63 g/mol. Its IUPAC name is hexyl (2S)-2-cyano-2-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]quinoxalin-2-yl]acetate.
| Compound Name | hexyl (2S)-2-cyano-2-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]quinoxalin-2-yl]acetate |
|---|---|
| PubChem CID | 40894937 |
| Molecular Formula | C29H35N5O2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | hexyl (2S)-2-cyano-2-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]quinoxalin-2-yl]acetate |
| SMILES | CCCCCCOC(=O)[C@H](C#N)c1nc2ccccc2nc1N1CCN(c2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C29H35N5O2/c1-4-5-6-9-19-36-29(35)23(20-30)27-28(32-25-13-8-7-12-24(25)31-27)34-17-15-33(16-18-34)26-14-10-11-21(2)22(26)3/h7-8,10-14,23H,4-6,9,15-19H2,1-3H3/t23-/m1/s1 |
| InChIKey | AXSVMWBWJAMOHW-HSZRJFAPSA-N |
| XLogP | 5.30 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|