C23H21FN4O2 — CID 142447184
(3-fluorophenyl)methyl 2-(3-piperazin-1-ylquinoxalin-2-yl)but-3-ynoate (PubChem CID 142447184) has the molecular formula C23H21FN4O2 and a molecular weight of 404.45 g/mol. Its IUPAC name is (3-fluorophenyl)methyl 2-(3-piperazin-1-ylquinoxalin-2-yl)but-3-ynoate.
| Compound Name | (3-fluorophenyl)methyl 2-(3-piperazin-1-ylquinoxalin-2-yl)but-3-ynoate |
|---|---|
| PubChem CID | 142447184 |
| Molecular Formula | C23H21FN4O2 |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (3-fluorophenyl)methyl 2-(3-piperazin-1-ylquinoxalin-2-yl)but-3-ynoate |
| SMILES | C#CC(C(=O)OCc1cccc(F)c1)c1nc2ccccc2nc1N1CCNCC1 |
| InChI | InChI=1S/C23H21FN4O2/c1-2-18(23(29)30-15-16-6-5-7-17(24)14-16)21-22(28-12-10-25-11-13-28)27-20-9-4-3-8-19(20)26-21/h1,3-9,14,18,25H,10-13,15H2 |
| InChIKey | ULNKYAPITVELSP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|