C21H20N6O2 — CID 164711566
pyridin-4-ylmethyl 2-cyano-2-(3-piperazin-1-ylquinoxalin-2-yl)acetate (PubChem CID 164711566) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is pyridin-4-ylmethyl 2-cyano-2-(3-piperazin-1-ylquinoxalin-2-yl)acetate.
| Compound Name | pyridin-4-ylmethyl 2-cyano-2-(3-piperazin-1-ylquinoxalin-2-yl)acetate |
|---|---|
| PubChem CID | 164711566 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | pyridin-4-ylmethyl 2-cyano-2-(3-piperazin-1-ylquinoxalin-2-yl)acetate |
| SMILES | N#CC(C(=O)OCc1ccncc1)c1nc2ccccc2nc1N1CCNCC1 |
| InChI | InChI=1S/C21H20N6O2/c22-13-16(21(28)29-14-15-5-7-23-8-6-15)19-20(27-11-9-24-10-12-27)26-18-4-2-1-3-17(18)25-19/h1-8,16,24H,9-12,14H2 |
| InChIKey | OQAFQVNHLJJJDL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |