About 1-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine
1-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine (PubChem CID 11426967) has the molecular formula C17H17ClN4
and a molecular weight of 312.80 g/mol. Its IUPAC name is 1-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine.
Molecular Properties
| Compound Name | 1-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine |
| PubChem CID | 11426967 |
| Molecular Formula | C17H17ClN4 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine |
| SMILES | Clc1cccc2c1Nc1ccccc1C(N1CCNCC1)=N2 |
| InChI | InChI=1S/C17H17ClN4/c18-13-5-3-7-15-16(13)20-14-6-2-1-4-12(14)17(21-15)22-10-8-19-9-11-22/h1-7,19-20H,8-11H2 |
| InChIKey | ONKWXZWWLSKJQX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine?
The IUPAC name of 1-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine (CID 11426967) is 1-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine.
What is the SMILES notation for 1-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine?
The canonical SMILES for 1-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine is Clc1cccc2c1Nc1ccccc1C(N1CCNCC1)=N2.
What is the InChIKey of 1-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine?
The InChIKey is ONKWXZWWLSKJQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN4/c18-13-5-3-7-15-16(13)20-14-6-2-1-4-12(14)17(21-15)22-10-8-19-9-11-22/h1-7,19-20H,8-11H2.
What are the key properties of 1-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine?
1-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine has a molecular weight of 312.80 g/mol, XLogP of 3.38, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine is sourced from PubChem (CID 11426967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).