C17H17ClN4 — CID 135409468
3-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine (PubChem CID 135409468) has the molecular formula C17H17ClN4 and a molecular weight of 312.80 g/mol. Its IUPAC name is 3-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine.
| Compound Name | 3-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine |
|---|---|
| PubChem CID | 135409468 |
| Molecular Formula | C17H17ClN4 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-chloro-6-piperazin-1-yl-11H-benzo[b][1,4]benzodiazepine |
| SMILES | Clc1ccc2c(c1)N=C(N1CCNCC1)c1ccccc1N2 |
| InChI | InChI=1S/C17H17ClN4/c18-12-5-6-15-16(11-12)21-17(22-9-7-19-8-10-22)13-3-1-2-4-14(13)20-15/h1-6,11,19-20H,7-10H2 |
| InChIKey | JNNOSTQEZICQQP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |