C22H22N6O — CID 135348739
(2Z)-N-benzyl-2-cyano-2-(3-piperazin-1-yl-1H-quinoxalin-2-ylidene)acetamide (PubChem CID 135348739) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is (2Z)-N-benzyl-2-cyano-2-(3-piperazin-1-yl-1H-quinoxalin-2-ylidene)acetamide.
| Compound Name | (2Z)-N-benzyl-2-cyano-2-(3-piperazin-1-yl-1H-quinoxalin-2-ylidene)acetamide |
|---|---|
| PubChem CID | 135348739 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | (2Z)-N-benzyl-2-cyano-2-(3-piperazin-1-yl-1H-quinoxalin-2-ylidene)acetamide |
| SMILES | N#C/C(C(=O)NCc1ccccc1)=C1/Nc2ccccc2N=C1N1CCNCC1 |
| InChI | InChI=1S/C22H22N6O/c23-14-17(22(29)25-15-16-6-2-1-3-7-16)20-21(28-12-10-24-11-13-28)27-19-9-5-4-8-18(19)26-20/h1-9,24,26H,10-13,15H2,(H,25,29)/b20-17- |
| InChIKey | SRCBRVUCWJLKBK-JZJYNLBNSA-N |
| XLogP | 2.14 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|